C23H24O5 — CID 161270994
5,15,16-tris(hydroxymethyl)-14-methoxy-12-methylidenetetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2(7),3,5,13(18),14,16-heptaen-6-ol (PubChem CID 161270994) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is 5,15,16-tris(hydroxymethyl)-14-methoxy-12-methylidenetetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2(7),3,5,13(18),14,16-heptaen-6-ol.
| Compound Name | 5,15,16-tris(hydroxymethyl)-14-methoxy-12-methylidenetetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2(7),3,5,13(18),14,16-heptaen-6-ol |
|---|---|
| PubChem CID | 161270994 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 5,15,16-tris(hydroxymethyl)-14-methoxy-12-methylidenetetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2(7),3,5,13(18),14,16-heptaen-6-ol |
| SMILES | C=C1C2=C(c3ccc(CO)c(O)c3CCC2)c2cc(CO)c(CO)c(OC)c21 |
| InChI | InChI=1S/C23H24O5/c1-12-15-4-3-5-17-16(7-6-13(9-24)22(17)27)21(15)18-8-14(10-25)19(11-26)23(28-2)20(12)18/h6-8,24-27H,1,3-5,9-11H2,2H3 |
| InChIKey | MSBUZMGRNCGBIO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |