About 2,3-dihydroisoindol-1-one;methane
2,3-dihydroisoindol-1-one;methane (PubChem CID 161271775) has the molecular formula C15H35NO
and a molecular weight of 245.45 g/mol. Its IUPAC name is 2,3-dihydroisoindol-1-one;methane.
Molecular Properties
| Compound Name | 2,3-dihydroisoindol-1-one;methane |
| PubChem CID | 161271775 |
| Molecular Formula | C15H35NO |
| Molecular Weight | 245.45 g/mol |
| Exact Mass | 245.27 |
| IUPAC Name | 2,3-dihydroisoindol-1-one;methane |
| SMILES | C.C.C.C.C.C.C.O=C1NCc2ccccc21 |
| InChI | InChI=1S/C8H7NO.7CH4/c10-8-7-4-2-1-3-6(7)5-9-8;;;;;;;/h1-4H,5H2,(H,9,10);7*1H4 |
| InChIKey | VDXLKIPKMFYCOZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 245.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dihydroisoindol-1-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroisoindol-1-one;methane?
The IUPAC name of 2,3-dihydroisoindol-1-one;methane (CID 161271775) is 2,3-dihydroisoindol-1-one;methane.
What is the SMILES notation for 2,3-dihydroisoindol-1-one;methane?
The canonical SMILES for 2,3-dihydroisoindol-1-one;methane is C.C.C.C.C.C.C.O=C1NCc2ccccc21.
What is the InChIKey of 2,3-dihydroisoindol-1-one;methane?
The InChIKey is VDXLKIPKMFYCOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO.7CH4/c10-8-7-4-2-1-3-6(7)5-9-8;;;;;;;/h1-4H,5H2,(H,9,10);7*1H4.
What are the key properties of 2,3-dihydroisoindol-1-one;methane?
2,3-dihydroisoindol-1-one;methane has a molecular weight of 245.45 g/mol, XLogP of 5.38, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroisoindol-1-one;methane is sourced from PubChem (CID 161271775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).