C15H35NO — CID 161271775
2,3-dihydroisoindol-1-one;methane (PubChem CID 161271775) has the molecular formula C15H35NO and a molecular weight of 245.45 g/mol. Its IUPAC name is 2,3-dihydroisoindol-1-one;methane.
| Compound Name | 2,3-dihydroisoindol-1-one;methane |
|---|---|
| PubChem CID | 161271775 |
| Molecular Formula | C15H35NO |
| Molecular Weight | 245.45 g/mol |
| Exact Mass | 245.27 |
| IUPAC Name | 2,3-dihydroisoindol-1-one;methane |
| SMILES | C.C.C.C.C.C.C.O=C1NCc2ccccc21 |
| InChI | InChI=1S/C8H7NO.7CH4/c10-8-7-4-2-1-3-6(7)5-9-8;;;;;;;/h1-4H,5H2,(H,9,10);7*1H4 |
| InChIKey | VDXLKIPKMFYCOZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |