C22H28F12O2S2 — CID 161272157
1,1,1,3,3,3-hexafluoro-2-[(5-sulfanyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-2-ol;1,1,1,3,3,3-hexafluoro-2-[(6-sulfanyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-2-ol (PubChem CID 161272157) has the molecular formula C22H28F12O2S2 and a molecular weight of 616.57 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[(5-sulfanyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-2-ol;1,1,1,3,3,3-hexafluoro-2-[(6-sulfanyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[(5-sulfanyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-2-ol;1,1,1,3,3,3-hexafluoro-2-[(6-sulfanyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-2-ol |
|---|---|
| PubChem CID | 161272157 |
| Molecular Formula | C22H28F12O2S2 |
| Molecular Weight | 616.57 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[(5-sulfanyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-2-ol;1,1,1,3,3,3-hexafluoro-2-[(6-sulfanyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-2-ol |
| SMILES | OC(CC1CC2CC(S)C1C2)(C(F)(F)F)C(F)(F)F.OC(CC1CC2CC1CC2S)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/2C11H14F6OS/c12-10(13,14)9(18,11(15,16)17)4-7-2-6-1-5(7)3-8(6)19;12-10(13,14)9(18,11(15,16)17)4-6-1-5-2-7(6)8(19)3-5/h2*5-8,18-19H,1-4H2 |
| InChIKey | VDYQOKMOBFMWMF-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.57 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|