C27H41NO6 — CID 161274616
methyl (1S,4R,6S,7Z,14R,18S)-18-methyl-14-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate (PubChem CID 161274616) has the molecular formula C27H41NO6 and a molecular weight of 475.63 g/mol. Its IUPAC name is methyl (1S,4R,6S,7Z,14R,18S)-18-methyl-14-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate.
| Compound Name | methyl (1S,4R,6S,7Z,14R,18S)-18-methyl-14-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 161274616 |
| Molecular Formula | C27H41NO6 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | methyl (1S,4R,6S,7Z,14R,18S)-18-methyl-14-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
| SMILES | COC(=O)[C@]12CC(=O)[C@@H]3C[C@H](C)CN3C(=O)[C@@H](CC(=O)OC(C)(C)C)CCCCC/C=C\[C@@H]1C2 |
| InChI | InChI=1S/C27H41NO6/c1-18-13-21-22(29)16-27(25(32)33-5)15-20(27)12-10-8-6-7-9-11-19(24(31)28(21)17-18)14-23(30)34-26(2,3)4/h10,12,18-21H,6-9,11,13-17H2,1-5H3/b12-10-/t18-,19+,20+,21-,27+/m0/s1 |
| InChIKey | WSJCIPYXFDAJFC-HUBFJYRXSA-N |
| XLogP | 4.23 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|