C18H18N4O6 — CID 161274784
(E)-but-2-enedioic acid;2-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-nitroquinoline (PubChem CID 161274784) has the molecular formula C18H18N4O6 and a molecular weight of 386.36 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-nitroquinoline.
| Compound Name | (E)-but-2-enedioic acid;2-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-nitroquinoline |
|---|---|
| PubChem CID | 161274784 |
| Molecular Formula | C18H18N4O6 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | (E)-but-2-enedioic acid;2-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-nitroquinoline |
| SMILES | O=C(O)/C=C/C(=O)O.O=[N+]([O-])c1ccc2nc(N3C[C@@H]4C[C@H]3CN4)ccc2c1 |
| InChI | InChI=1S/C14H14N4O2.C4H4O4/c19-18(20)11-2-3-13-9(5-11)1-4-14(16-13)17-8-10-6-12(17)7-15-10;5-3(6)1-2-4(7)8/h1-5,10,12,15H,6-8H2;1-2H,(H,5,6)(H,7,8)/b;2-1+/t10-,12-;/m0./s1 |
| InChIKey | VEHFYQXMTGWDLF-BNEOOWBWSA-N |
| XLogP | 1.41 |
| TPSA | 145.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|