C39H52 — CID 161275085
(4aR,11R,11aS,12S,12aS)-8-(2,4-dimethylidenehexyl)-4,4a,5,7,11,11a,12,12a-octamethyl-2,6-dimethylidene-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracene (PubChem CID 161275085) has the molecular formula C39H52 and a molecular weight of 520.85 g/mol. Its IUPAC name is (4aR,11R,11aS,12S,12aS)-8-(2,4-dimethylidenehexyl)-4,4a,5,7,11,11a,12,12a-octamethyl-2,6-dimethylidene-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracene.
| Compound Name | (4aR,11R,11aS,12S,12aS)-8-(2,4-dimethylidenehexyl)-4,4a,5,7,11,11a,12,12a-octamethyl-2,6-dimethylidene-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracene |
|---|---|
| PubChem CID | 161275085 |
| Molecular Formula | C39H52 |
| Molecular Weight | 520.85 g/mol |
| Exact Mass | 520.41 |
| IUPAC Name | (4aR,11R,11aS,12S,12aS)-8-(2,4-dimethylidenehexyl)-4,4a,5,7,11,11a,12,12a-octamethyl-2,6-dimethylidene-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracene |
| SMILES | C=C(CC)CC(=C)Cc1ccc2c(c1C)C(=C)C1=C(C)[C@@]3(C)C(C)=C(C(=C)C)C(=C)C[C@@]3(C)[C@H](C)[C@@]1(C)[C@@H]2C |
| InChI | InChI=1S/C39H52/c1-16-23(4)19-24(5)20-32-17-18-33-28(9)38(14)31(12)37(13)21-25(6)34(22(2)3)29(10)39(37,15)30(11)36(38)27(8)35(33)26(32)7/h17-18,28,31H,2,4-6,8,16,19-21H2,1,3,7,9-15H3/t28-,31+,37+,38-,39-/m1/s1 |
| InChIKey | VEIHXPZCORLUNJ-CTGLTGEBSA-N |
| XLogP | 11.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.85 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|