About methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate;methyl 3-hydroxy-2-(thian-4-yl)butanoate
methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate;methyl 3-hydroxy-2-(thian-4-yl)butanoate (PubChem CID 161276199) has the molecular formula C20H36O8S2
and a molecular weight of 468.63 g/mol. Its IUPAC name is methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate;methyl 3-hydroxy-2-(thian-4-yl)butanoate.
Molecular Properties
| Compound Name | methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate;methyl 3-hydroxy-2-(thian-4-yl)butanoate |
| PubChem CID | 161276199 |
| Molecular Formula | C20H36O8S2 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate;methyl 3-hydroxy-2-(thian-4-yl)butanoate |
| SMILES | COC(=O)C(C(C)O)C1CCS(=O)(=O)CC1.COC(=O)C(C(C)O)C1CCSCC1 |
| InChI | InChI=1S/C10H18O5S.C10H18O3S/c1-7(11)9(10(12)15-2)8-3-5-16(13,14)6-4-8;1-7(11)9(10(12)13-2)8-3-5-14-6-4-8/h7-9,11H,3-6H2,1-2H3;7-9,11H,3-6H2,1-2H3 |
| InChIKey | VELXOIUTYYIRPC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate;methyl 3-hydroxy-2-(thian-4-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate;methyl 3-hydroxy-2-(thian-4-yl)butanoate?
The IUPAC name of methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate;methyl 3-hydroxy-2-(thian-4-yl)butanoate (CID 161276199) is methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate;methyl 3-hydroxy-2-(thian-4-yl)butanoate.
What is the SMILES notation for methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate;methyl 3-hydroxy-2-(thian-4-yl)butanoate?
The canonical SMILES for methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate;methyl 3-hydroxy-2-(thian-4-yl)butanoate is COC(=O)C(C(C)O)C1CCS(=O)(=O)CC1.COC(=O)C(C(C)O)C1CCSCC1.
What is the InChIKey of methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate;methyl 3-hydroxy-2-(thian-4-yl)butanoate?
The InChIKey is VELXOIUTYYIRPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5S.C10H18O3S/c1-7(11)9(10(12)15-2)8-3-5-16(13,14)6-4-8;1-7(11)9(10(12)13-2)8-3-5-14-6-4-8/h7-9,11H,3-6H2,1-2H3;7-9,11H,3-6H2,1-2H3.
What are the key properties of methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate;methyl 3-hydroxy-2-(thian-4-yl)butanoate?
methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate;methyl 3-hydroxy-2-(thian-4-yl)butanoate has a molecular weight of 468.63 g/mol, XLogP of 1.28, 6 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate;methyl 3-hydroxy-2-(thian-4-yl)butanoate is sourced from PubChem (CID 161276199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).