About 1-chloro-3-ethoxyisoquinoline;3-ethoxy-2H-isoquinolin-1-one;methyl 2-(cyanomethyl)benzoate
1-chloro-3-ethoxyisoquinoline;3-ethoxy-2H-isoquinolin-1-one;methyl 2-(cyanomethyl)benzoate (PubChem CID 161277361) has the molecular formula C32H30ClN3O5
and a molecular weight of 572.06 g/mol. Its IUPAC name is 1-chloro-3-ethoxyisoquinoline;3-ethoxy-2H-isoquinolin-1-one;methyl 2-(cyanomethyl)benzoate.
Molecular Properties
| Compound Name | 1-chloro-3-ethoxyisoquinoline;3-ethoxy-2H-isoquinolin-1-one;methyl 2-(cyanomethyl)benzoate |
| PubChem CID | 161277361 |
| Molecular Formula | C32H30ClN3O5 |
| Molecular Weight | 572.06 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | 1-chloro-3-ethoxyisoquinoline;3-ethoxy-2H-isoquinolin-1-one;methyl 2-(cyanomethyl)benzoate |
| SMILES | CCOc1cc2ccccc2c(=O)[nH]1.CCOc1cc2ccccc2c(Cl)n1.COC(=O)c1ccccc1CC#N |
| InChI | InChI=1S/C11H10ClNO.C11H11NO2.C10H9NO2/c1-2-14-10-7-8-5-3-4-6-9(8)11(12)13-10;1-2-14-10-7-8-5-3-4-6-9(8)11(13)12-10;1-13-10(12)9-5-3-2-4-8(9)6-7-11/h3-7H,2H2,1H3;3-7H,2H2,1H3,(H,12,13);2-5H,6H2,1H3 |
| InChIKey | VEPRLKSEFUQPTI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.06 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-ethoxyisoquinoline;3-ethoxy-2H-isoquinolin-1-one;methyl 2-(cyanomethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-ethoxyisoquinoline;3-ethoxy-2H-isoquinolin-1-one;methyl 2-(cyanomethyl)benzoate?
The IUPAC name of 1-chloro-3-ethoxyisoquinoline;3-ethoxy-2H-isoquinolin-1-one;methyl 2-(cyanomethyl)benzoate (CID 161277361) is 1-chloro-3-ethoxyisoquinoline;3-ethoxy-2H-isoquinolin-1-one;methyl 2-(cyanomethyl)benzoate.
What is the SMILES notation for 1-chloro-3-ethoxyisoquinoline;3-ethoxy-2H-isoquinolin-1-one;methyl 2-(cyanomethyl)benzoate?
The canonical SMILES for 1-chloro-3-ethoxyisoquinoline;3-ethoxy-2H-isoquinolin-1-one;methyl 2-(cyanomethyl)benzoate is CCOc1cc2ccccc2c(=O)[nH]1.CCOc1cc2ccccc2c(Cl)n1.COC(=O)c1ccccc1CC#N.
What is the InChIKey of 1-chloro-3-ethoxyisoquinoline;3-ethoxy-2H-isoquinolin-1-one;methyl 2-(cyanomethyl)benzoate?
The InChIKey is VEPRLKSEFUQPTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO.C11H11NO2.C10H9NO2/c1-2-14-10-7-8-5-3-4-6-9(8)11(12)13-10;1-2-14-10-7-8-5-3-4-6-9(8)11(13)12-10;1-13-10(12)9-5-3-2-4-8(9)6-7-11/h3-7H,2H2,1H3;3-7H,2H2,1H3,(H,12,13);2-5H,6H2,1H3.
What are the key properties of 1-chloro-3-ethoxyisoquinoline;3-ethoxy-2H-isoquinolin-1-one;methyl 2-(cyanomethyl)benzoate?
1-chloro-3-ethoxyisoquinoline;3-ethoxy-2H-isoquinolin-1-one;methyl 2-(cyanomethyl)benzoate has a molecular weight of 572.06 g/mol, XLogP of 6.75, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-ethoxyisoquinoline;3-ethoxy-2H-isoquinolin-1-one;methyl 2-(cyanomethyl)benzoate is sourced from PubChem (CID 161277361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).