About (2-adamantylideneamino) 4-ethenylbenzenesulfonate;N-(2-adamantylidene)hydroxylamine
(2-adamantylideneamino) 4-ethenylbenzenesulfonate;N-(2-adamantylidene)hydroxylamine (PubChem CID 161277517) has the molecular formula C28H36N2O4S
and a molecular weight of 496.67 g/mol. Its IUPAC name is (2-adamantylideneamino) 4-ethenylbenzenesulfonate;N-(2-adamantylidene)hydroxylamine.
Molecular Properties
| Compound Name | (2-adamantylideneamino) 4-ethenylbenzenesulfonate;N-(2-adamantylidene)hydroxylamine |
| PubChem CID | 161277517 |
| Molecular Formula | C28H36N2O4S |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | (2-adamantylideneamino) 4-ethenylbenzenesulfonate;N-(2-adamantylidene)hydroxylamine |
| SMILES | C=Cc1ccc(S(=O)(=O)ON=C2C3CC4CC(C3)CC2C4)cc1.ON=C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H21NO3S.C10H15NO/c1-2-12-3-5-17(6-4-12)23(20,21)22-19-18-15-8-13-7-14(10-15)11-16(18)9-13;12-11-10-8-2-6-1-7(4-8)5-9(10)3-6/h2-6,13-16H,1,7-11H2;6-9,12H,1-5H2/b19-18-;11-10- |
| InChIKey | VEQDYNODXAPGPK-DWLBEOTPSA-N |
| XLogP | 6.12 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-adamantylideneamino) 4-ethenylbenzenesulfonate;N-(2-adamantylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-adamantylideneamino) 4-ethenylbenzenesulfonate;N-(2-adamantylidene)hydroxylamine?
The IUPAC name of (2-adamantylideneamino) 4-ethenylbenzenesulfonate;N-(2-adamantylidene)hydroxylamine (CID 161277517) is (2-adamantylideneamino) 4-ethenylbenzenesulfonate;N-(2-adamantylidene)hydroxylamine.
What is the SMILES notation for (2-adamantylideneamino) 4-ethenylbenzenesulfonate;N-(2-adamantylidene)hydroxylamine?
The canonical SMILES for (2-adamantylideneamino) 4-ethenylbenzenesulfonate;N-(2-adamantylidene)hydroxylamine is C=Cc1ccc(S(=O)(=O)ON=C2C3CC4CC(C3)CC2C4)cc1.ON=C1C2CC3CC(C2)CC1C3.
What is the InChIKey of (2-adamantylideneamino) 4-ethenylbenzenesulfonate;N-(2-adamantylidene)hydroxylamine?
The InChIKey is VEQDYNODXAPGPK-DWLBEOTPSA-N. The full InChI is InChI=1S/C18H21NO3S.C10H15NO/c1-2-12-3-5-17(6-4-12)23(20,21)22-19-18-15-8-13-7-14(10-15)11-16(18)9-13;12-11-10-8-2-6-1-7(4-8)5-9(10)3-6/h2-6,13-16H,1,7-11H2;6-9,12H,1-5H2/b19-18-;11-10-.
What are the key properties of (2-adamantylideneamino) 4-ethenylbenzenesulfonate;N-(2-adamantylidene)hydroxylamine?
(2-adamantylideneamino) 4-ethenylbenzenesulfonate;N-(2-adamantylidene)hydroxylamine has a molecular weight of 496.67 g/mol, XLogP of 6.12, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-adamantylideneamino) 4-ethenylbenzenesulfonate;N-(2-adamantylidene)hydroxylamine is sourced from PubChem (CID 161277517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).