C20H23BO — CID 161277779
2-(9H-fluoren-2-yl)-4,4,5,5-tetramethyloxaborolane (PubChem CID 161277779) has the molecular formula C20H23BO and a molecular weight of 290.21 g/mol. Its IUPAC name is 2-(9H-fluoren-2-yl)-4,4,5,5-tetramethyloxaborolane.
| Compound Name | 2-(9H-fluoren-2-yl)-4,4,5,5-tetramethyloxaborolane |
|---|---|
| PubChem CID | 161277779 |
| Molecular Formula | C20H23BO |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-(9H-fluoren-2-yl)-4,4,5,5-tetramethyloxaborolane |
| SMILES | CC1(C)CB(c2ccc3c(c2)Cc2ccccc2-3)OC1(C)C |
| InChI | InChI=1S/C20H23BO/c1-19(2)13-21(22-20(19,3)4)16-9-10-18-15(12-16)11-14-7-5-6-8-17(14)18/h5-10,12H,11,13H2,1-4H3 |
| InChIKey | VERBHESRAKDITH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|