C10H5F15O6 — CID 161279187
bis(1,1,2,2,2-pentafluoroethyl) carbonate;ethyl 1,1,2,2,2-pentafluoroethyl carbonate (PubChem CID 161279187) has the molecular formula C10H5F15O6 and a molecular weight of 506.11 g/mol. Its IUPAC name is bis(1,1,2,2,2-pentafluoroethyl) carbonate;ethyl 1,1,2,2,2-pentafluoroethyl carbonate.
| Compound Name | bis(1,1,2,2,2-pentafluoroethyl) carbonate;ethyl 1,1,2,2,2-pentafluoroethyl carbonate |
|---|---|
| PubChem CID | 161279187 |
| Molecular Formula | C10H5F15O6 |
| Molecular Weight | 506.11 g/mol |
| Exact Mass | 505.98 |
| IUPAC Name | bis(1,1,2,2,2-pentafluoroethyl) carbonate;ethyl 1,1,2,2,2-pentafluoroethyl carbonate |
| SMILES | CCOC(=O)OC(F)(F)C(F)(F)F.O=C(OC(F)(F)C(F)(F)F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5F10O3.C5H5F5O3/c6-2(7,8)4(12,13)17-1(16)18-5(14,15)3(9,10)11;1-2-12-3(11)13-5(9,10)4(6,7)8/h;2H2,1H3 |
| InChIKey | VEVSCIMBDURWLK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.11 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|