C12H11F6NO3S — CID 161279554
1,1,1,4,4,4-hexafluorobutane-2,3-dione;N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 161279554) has the molecular formula C12H11F6NO3S and a molecular weight of 363.28 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluorobutane-2,3-dione;N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 161279554 |
| Molecular Formula | C12H11F6NO3S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | CC(=O)NCCc1cccs1.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H11NOS.C4F6O2/c1-7(10)9-5-4-8-3-2-6-11-8;5-3(6,7)1(11)2(12)4(8,9)10/h2-3,6H,4-5H2,1H3,(H,9,10); |
| InChIKey | VEXAHGURIPSJGQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|