C17H19Cl2NO4 — CID 161280688
methyl 4,5-dichloro-1-methyl-6-(2-oxohexoxy)indole-2-carboxylate (PubChem CID 161280688) has the molecular formula C17H19Cl2NO4 and a molecular weight of 372.25 g/mol. Its IUPAC name is methyl 4,5-dichloro-1-methyl-6-(2-oxohexoxy)indole-2-carboxylate.
| Compound Name | methyl 4,5-dichloro-1-methyl-6-(2-oxohexoxy)indole-2-carboxylate |
|---|---|
| PubChem CID | 161280688 |
| Molecular Formula | C17H19Cl2NO4 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | methyl 4,5-dichloro-1-methyl-6-(2-oxohexoxy)indole-2-carboxylate |
| SMILES | CCCCC(=O)COc1cc2c(cc(C(=O)OC)n2C)c(Cl)c1Cl |
| InChI | InChI=1S/C17H19Cl2NO4/c1-4-5-6-10(21)9-24-14-8-12-11(15(18)16(14)19)7-13(20(12)2)17(22)23-3/h7-8H,4-6,9H2,1-3H3 |
| InChIKey | CXGMNJZUKCWRAA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |