About 6-chloro-N-[4-(3,5-dichlorophenyl)butyl]-1H-imidazo[4,5-b]pyridin-2-amine
6-chloro-N-[4-(3,5-dichlorophenyl)butyl]-1H-imidazo[4,5-b]pyridin-2-amine (PubChem CID 161280733) has the molecular formula C16H15Cl3N4
and a molecular weight of 369.68 g/mol. Its IUPAC name is 6-chloro-N-[4-(3,5-dichlorophenyl)butyl]-1H-imidazo[4,5-b]pyridin-2-amine.
Molecular Properties
| Compound Name | 6-chloro-N-[4-(3,5-dichlorophenyl)butyl]-1H-imidazo[4,5-b]pyridin-2-amine |
| PubChem CID | 161280733 |
| Molecular Formula | C16H15Cl3N4 |
| Molecular Weight | 369.68 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 6-chloro-N-[4-(3,5-dichlorophenyl)butyl]-1H-imidazo[4,5-b]pyridin-2-amine |
| SMILES | Clc1cc(Cl)cc(CCCCNc2nc3ncc(Cl)cc3[nH]2)c1 |
| InChI | InChI=1S/C16H15Cl3N4/c17-11-5-10(6-12(18)7-11)3-1-2-4-20-16-22-14-8-13(19)9-21-15(14)23-16/h5-9H,1-4H2,(H2,20,21,22,23) |
| InChIKey | VFAXQTOHBWPRLB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-[4-(3,5-dichlorophenyl)butyl]-1H-imidazo[4,5-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-[4-(3,5-dichlorophenyl)butyl]-1H-imidazo[4,5-b]pyridin-2-amine?
The IUPAC name of 6-chloro-N-[4-(3,5-dichlorophenyl)butyl]-1H-imidazo[4,5-b]pyridin-2-amine (CID 161280733) is 6-chloro-N-[4-(3,5-dichlorophenyl)butyl]-1H-imidazo[4,5-b]pyridin-2-amine.
What is the SMILES notation for 6-chloro-N-[4-(3,5-dichlorophenyl)butyl]-1H-imidazo[4,5-b]pyridin-2-amine?
The canonical SMILES for 6-chloro-N-[4-(3,5-dichlorophenyl)butyl]-1H-imidazo[4,5-b]pyridin-2-amine is Clc1cc(Cl)cc(CCCCNc2nc3ncc(Cl)cc3[nH]2)c1.
What is the InChIKey of 6-chloro-N-[4-(3,5-dichlorophenyl)butyl]-1H-imidazo[4,5-b]pyridin-2-amine?
The InChIKey is VFAXQTOHBWPRLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl3N4/c17-11-5-10(6-12(18)7-11)3-1-2-4-20-16-22-14-8-13(19)9-21-15(14)23-16/h5-9H,1-4H2,(H2,20,21,22,23).
What are the key properties of 6-chloro-N-[4-(3,5-dichlorophenyl)butyl]-1H-imidazo[4,5-b]pyridin-2-amine?
6-chloro-N-[4-(3,5-dichlorophenyl)butyl]-1H-imidazo[4,5-b]pyridin-2-amine has a molecular weight of 369.68 g/mol, XLogP of 5.35, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-[4-(3,5-dichlorophenyl)butyl]-1H-imidazo[4,5-b]pyridin-2-amine is sourced from PubChem (CID 161280733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).