About tert-butyl 4-(oxan-4-yl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;oxan-4-one
tert-butyl 4-(oxan-4-yl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;oxan-4-one (PubChem CID 161281114) has the molecular formula C28H52N4O7
and a molecular weight of 556.75 g/mol. Its IUPAC name is tert-butyl 4-(oxan-4-yl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;oxan-4-one.
Molecular Properties
| Compound Name | tert-butyl 4-(oxan-4-yl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;oxan-4-one |
| PubChem CID | 161281114 |
| Molecular Formula | C28H52N4O7 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.38 |
| IUPAC Name | tert-butyl 4-(oxan-4-yl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;oxan-4-one |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2CCOCC2)CC1.CC(C)(C)OC(=O)N1CCNCC1.O=C1CCOCC1 |
| InChI | InChI=1S/C14H26N2O3.C9H18N2O2.C5H8O2/c1-14(2,3)19-13(17)16-8-6-15(7-9-16)12-4-10-18-11-5-12;1-9(2,3)13-8(12)11-6-4-10-5-7-11;6-5-1-3-7-4-2-5/h12H,4-11H2,1-3H3;10H,4-7H2,1-3H3;1-4H2 |
| InChIKey | VFCDQVOECSQQAN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze tert-butyl 4-(oxan-4-yl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;oxan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(oxan-4-yl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;oxan-4-one?
The IUPAC name of tert-butyl 4-(oxan-4-yl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;oxan-4-one (CID 161281114) is tert-butyl 4-(oxan-4-yl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;oxan-4-one.
What is the SMILES notation for tert-butyl 4-(oxan-4-yl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;oxan-4-one?
The canonical SMILES for tert-butyl 4-(oxan-4-yl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;oxan-4-one is CC(C)(C)OC(=O)N1CCN(C2CCOCC2)CC1.CC(C)(C)OC(=O)N1CCNCC1.O=C1CCOCC1.
What is the InChIKey of tert-butyl 4-(oxan-4-yl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;oxan-4-one?
The InChIKey is VFCDQVOECSQQAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O3.C9H18N2O2.C5H8O2/c1-14(2,3)19-13(17)16-8-6-15(7-9-16)12-4-10-18-11-5-12;1-9(2,3)13-8(12)11-6-4-10-5-7-11;6-5-1-3-7-4-2-5/h12H,4-11H2,1-3H3;10H,4-7H2,1-3H3;1-4H2.
What are the key properties of tert-butyl 4-(oxan-4-yl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;oxan-4-one?
tert-butyl 4-(oxan-4-yl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;oxan-4-one has a molecular weight of 556.75 g/mol, XLogP of 2.91, 1 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(oxan-4-yl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;oxan-4-one is sourced from PubChem (CID 161281114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).