C26H34O7 — CID 161281171
ethyl 2-acetyloxy-4-phenylbutanoate;ethyl 2-hydroxy-4-phenylbutanoate (PubChem CID 161281171) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is ethyl 2-acetyloxy-4-phenylbutanoate;ethyl 2-hydroxy-4-phenylbutanoate.
| Compound Name | ethyl 2-acetyloxy-4-phenylbutanoate;ethyl 2-hydroxy-4-phenylbutanoate |
|---|---|
| PubChem CID | 161281171 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | ethyl 2-acetyloxy-4-phenylbutanoate;ethyl 2-hydroxy-4-phenylbutanoate |
| SMILES | CCOC(=O)C(CCc1ccccc1)OC(C)=O.CCOC(=O)C(O)CCc1ccccc1 |
| InChI | InChI=1S/C14H18O4.C12H16O3/c1-3-17-14(16)13(18-11(2)15)10-9-12-7-5-4-6-8-12;1-2-15-12(14)11(13)9-8-10-6-4-3-5-7-10/h4-8,13H,3,9-10H2,1-2H3;3-7,11,13H,2,8-9H2,1H3 |
| InChIKey | VFCJLTHRIHLSRH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|