C40H26BkN3- — CID 161281181
berkelium;3-methanidyl-2-[4-(9-phenylcarbazol-3-yl)phenyl]phenanthro[9,10-d]imidazole (PubChem CID 161281181) has the molecular formula C40H26BkN3- and a molecular weight of 795.67 g/mol. Its IUPAC name is berkelium;3-methanidyl-2-[4-(9-phenylcarbazol-3-yl)phenyl]phenanthro[9,10-d]imidazole.
| Compound Name | berkelium;3-methanidyl-2-[4-(9-phenylcarbazol-3-yl)phenyl]phenanthro[9,10-d]imidazole |
|---|---|
| PubChem CID | 161281181 |
| Molecular Formula | C40H26BkN3- |
| Molecular Weight | 795.67 g/mol |
| Exact Mass | 795.28 |
| IUPAC Name | berkelium;3-methanidyl-2-[4-(9-phenylcarbazol-3-yl)phenyl]phenanthro[9,10-d]imidazole |
| SMILES | [Bk].[CH2-]n1c(-c2ccc(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3)cc2)nc2c3ccccc3c3ccccc3c21 |
| InChI | InChI=1S/C40H26N3.Bk/c1-42-39-34-17-8-6-14-31(34)30-13-5-7-16-33(30)38(39)41-40(42)27-21-19-26(20-22-27)28-23-24-37-35(25-28)32-15-9-10-18-36(32)43(37)29-11-3-2-4-12-29;/h2-25H,1H2;/q-1; |
| InChIKey | CJOLTHJPEQKFJH-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.67 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|