About 3-[2-(2,5-dimethylphenyl)ethyl]piperidine-2,6-dione;ethane
3-[2-(2,5-dimethylphenyl)ethyl]piperidine-2,6-dione;ethane (PubChem CID 161281215) has the molecular formula C17H25NO2
and a molecular weight of 275.39 g/mol. Its IUPAC name is 3-[2-(2,5-dimethylphenyl)ethyl]piperidine-2,6-dione;ethane.
Molecular Properties
| Compound Name | 3-[2-(2,5-dimethylphenyl)ethyl]piperidine-2,6-dione;ethane |
| PubChem CID | 161281215 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 3-[2-(2,5-dimethylphenyl)ethyl]piperidine-2,6-dione;ethane |
| SMILES | CC.Cc1ccc(C)c(CCC2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C15H19NO2.C2H6/c1-10-3-4-11(2)13(9-10)6-5-12-7-8-14(17)16-15(12)18;1-2/h3-4,9,12H,5-8H2,1-2H3,(H,16,17,18);1-2H3 |
| InChIKey | VFCMWGPPBHBIIZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2,5-dimethylphenyl)ethyl]piperidine-2,6-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,5-dimethylphenyl)ethyl]piperidine-2,6-dione;ethane?
The IUPAC name of 3-[2-(2,5-dimethylphenyl)ethyl]piperidine-2,6-dione;ethane (CID 161281215) is 3-[2-(2,5-dimethylphenyl)ethyl]piperidine-2,6-dione;ethane.
What is the SMILES notation for 3-[2-(2,5-dimethylphenyl)ethyl]piperidine-2,6-dione;ethane?
The canonical SMILES for 3-[2-(2,5-dimethylphenyl)ethyl]piperidine-2,6-dione;ethane is CC.Cc1ccc(C)c(CCC2CCC(=O)NC2=O)c1.
What is the InChIKey of 3-[2-(2,5-dimethylphenyl)ethyl]piperidine-2,6-dione;ethane?
The InChIKey is VFCMWGPPBHBIIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO2.C2H6/c1-10-3-4-11(2)13(9-10)6-5-12-7-8-14(17)16-15(12)18;1-2/h3-4,9,12H,5-8H2,1-2H3,(H,16,17,18);1-2H3.
What are the key properties of 3-[2-(2,5-dimethylphenyl)ethyl]piperidine-2,6-dione;ethane?
3-[2-(2,5-dimethylphenyl)ethyl]piperidine-2,6-dione;ethane has a molecular weight of 275.39 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,5-dimethylphenyl)ethyl]piperidine-2,6-dione;ethane is sourced from PubChem (CID 161281215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).