About 2-methyl-1H-isoquinoline;1-methyl-2H-quinoline
2-methyl-1H-isoquinoline;1-methyl-2H-quinoline (PubChem CID 161281450) has the molecular formula C20H22N2
and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-methyl-1H-isoquinoline;1-methyl-2H-quinoline.
Molecular Properties
| Compound Name | 2-methyl-1H-isoquinoline;1-methyl-2H-quinoline |
| PubChem CID | 161281450 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-methyl-1H-isoquinoline;1-methyl-2H-quinoline |
| SMILES | CN1C=Cc2ccccc2C1.CN1CC=Cc2ccccc21 |
| InChI | InChI=1S/2C10H11N/c1-11-8-4-6-9-5-2-3-7-10(9)11;1-11-7-6-9-4-2-3-5-10(9)8-11/h2*2-7H,8H2,1H3 |
| InChIKey | VFDJSQZPPGXEFK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1H-isoquinoline;1-methyl-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1H-isoquinoline;1-methyl-2H-quinoline?
The IUPAC name of 2-methyl-1H-isoquinoline;1-methyl-2H-quinoline (CID 161281450) is 2-methyl-1H-isoquinoline;1-methyl-2H-quinoline.
What is the SMILES notation for 2-methyl-1H-isoquinoline;1-methyl-2H-quinoline?
The canonical SMILES for 2-methyl-1H-isoquinoline;1-methyl-2H-quinoline is CN1C=Cc2ccccc2C1.CN1CC=Cc2ccccc21.
What is the InChIKey of 2-methyl-1H-isoquinoline;1-methyl-2H-quinoline?
The InChIKey is VFDJSQZPPGXEFK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H11N/c1-11-8-4-6-9-5-2-3-7-10(9)11;1-11-7-6-9-4-2-3-5-10(9)8-11/h2*2-7H,8H2,1H3.
What are the key properties of 2-methyl-1H-isoquinoline;1-methyl-2H-quinoline?
2-methyl-1H-isoquinoline;1-methyl-2H-quinoline has a molecular weight of 290.41 g/mol, XLogP of 4.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1H-isoquinoline;1-methyl-2H-quinoline is sourced from PubChem (CID 161281450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).