C17H12Cl3N5O4 — CID 161281792
N-benzyl-6-chloro-4-nitropyridin-2-amine;2,6-dichloro-4-nitropyridine (PubChem CID 161281792) has the molecular formula C17H12Cl3N5O4 and a molecular weight of 456.67 g/mol. Its IUPAC name is N-benzyl-6-chloro-4-nitropyridin-2-amine;2,6-dichloro-4-nitropyridine.
| Compound Name | N-benzyl-6-chloro-4-nitropyridin-2-amine;2,6-dichloro-4-nitropyridine |
|---|---|
| PubChem CID | 161281792 |
| Molecular Formula | C17H12Cl3N5O4 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | N-benzyl-6-chloro-4-nitropyridin-2-amine;2,6-dichloro-4-nitropyridine |
| SMILES | O=[N+]([O-])c1cc(Cl)nc(Cl)c1.O=[N+]([O-])c1cc(Cl)nc(NCc2ccccc2)c1 |
| InChI | InChI=1S/C12H10ClN3O2.C5H2Cl2N2O2/c13-11-6-10(16(17)18)7-12(15-11)14-8-9-4-2-1-3-5-9;6-4-1-3(9(10)11)2-5(7)8-4/h1-7H,8H2,(H,14,15);1-2H |
| InChIKey | VFENSBIVOYPBTM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|