C14H24F6O2 — CID 161281823
2-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-1,1,1,3,3,3-hexafluoropropan-2-ol;methane (PubChem CID 161281823) has the molecular formula C14H24F6O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is 2-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-1,1,1,3,3,3-hexafluoropropan-2-ol;methane.
| Compound Name | 2-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-1,1,1,3,3,3-hexafluoropropan-2-ol;methane |
|---|---|
| PubChem CID | 161281823 |
| Molecular Formula | C14H24F6O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-1,1,1,3,3,3-hexafluoropropan-2-ol;methane |
| SMILES | C.C.CC1C2CC(OC(O)(C(F)(F)F)C(F)(F)F)C(C2)C1C |
| InChI | InChI=1S/C12H16F6O2.2CH4/c1-5-6(2)8-3-7(5)4-9(8)20-10(19,11(13,14)15)12(16,17)18;;/h5-9,19H,3-4H2,1-2H3;2*1H4 |
| InChIKey | VFEQOQCUQVZKQA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|