C20H40N2OSSi — CID 161283631
tert-butyl-hydroxy-dimethylsilane;(1S)-N-methyl-1-(3-methylphenyl)-2-pyrrolidin-1-ylethanamine;sulfane (PubChem CID 161283631) has the molecular formula C20H40N2OSSi and a molecular weight of 384.71 g/mol. Its IUPAC name is tert-butyl-hydroxy-dimethylsilane;(1S)-N-methyl-1-(3-methylphenyl)-2-pyrrolidin-1-ylethanamine;sulfane.
| Compound Name | tert-butyl-hydroxy-dimethylsilane;(1S)-N-methyl-1-(3-methylphenyl)-2-pyrrolidin-1-ylethanamine;sulfane |
|---|---|
| PubChem CID | 161283631 |
| Molecular Formula | C20H40N2OSSi |
| Molecular Weight | 384.71 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | tert-butyl-hydroxy-dimethylsilane;(1S)-N-methyl-1-(3-methylphenyl)-2-pyrrolidin-1-ylethanamine;sulfane |
| SMILES | CC(C)(C)[Si](C)(C)O.CN[C@H](CN1CCCC1)c1cccc(C)c1.S |
| InChI | InChI=1S/C14H22N2.C6H16OSi.H2S/c1-12-6-5-7-13(10-12)14(15-2)11-16-8-3-4-9-16;1-6(2,3)8(4,5)7;/h5-7,10,14-15H,3-4,8-9,11H2,1-2H3;7H,1-5H3;1H2/t14-;;/m1../s1 |
| InChIKey | VFKQVKPFANJLOZ-FMOMHUKBSA-N |
| XLogP | 4.45 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.71 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|