C20H25Br3F2O2 — CID 161283859
1-(4-bromobutoxy)-2-fluorobenzene;1,4-dibromobutane;2-fluorophenol (PubChem CID 161283859) has the molecular formula C20H25Br3F2O2 and a molecular weight of 575.13 g/mol. Its IUPAC name is 1-(4-bromobutoxy)-2-fluorobenzene;1,4-dibromobutane;2-fluorophenol.
| Compound Name | 1-(4-bromobutoxy)-2-fluorobenzene;1,4-dibromobutane;2-fluorophenol |
|---|---|
| PubChem CID | 161283859 |
| Molecular Formula | C20H25Br3F2O2 |
| Molecular Weight | 575.13 g/mol |
| Exact Mass | 571.94 |
| IUPAC Name | 1-(4-bromobutoxy)-2-fluorobenzene;1,4-dibromobutane;2-fluorophenol |
| SMILES | BrCCCCBr.Fc1ccccc1OCCCCBr.Oc1ccccc1F |
| InChI | InChI=1S/C10H12BrFO.C6H5FO.C4H8Br2/c11-7-3-4-8-13-10-6-2-1-5-9(10)12;7-5-3-1-2-4-6(5)8;5-3-1-2-4-6/h1-2,5-6H,3-4,7-8H2;1-4,8H;1-4H2 |
| InChIKey | VFLLPSFUVSTIHI-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.13 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|