C20H40N2O9 — CID 161284144
2,2-dimethoxyethanamine;N-(2,2-dimethoxyethyl)-2-oxopentanamide;ethyl 2-oxopentanoate (PubChem CID 161284144) has the molecular formula C20H40N2O9 and a molecular weight of 452.55 g/mol. Its IUPAC name is 2,2-dimethoxyethanamine;N-(2,2-dimethoxyethyl)-2-oxopentanamide;ethyl 2-oxopentanoate.
| Compound Name | 2,2-dimethoxyethanamine;N-(2,2-dimethoxyethyl)-2-oxopentanamide;ethyl 2-oxopentanoate |
|---|---|
| PubChem CID | 161284144 |
| Molecular Formula | C20H40N2O9 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 2,2-dimethoxyethanamine;N-(2,2-dimethoxyethyl)-2-oxopentanamide;ethyl 2-oxopentanoate |
| SMILES | CCCC(=O)C(=O)NCC(OC)OC.CCCC(=O)C(=O)OCC.COC(CN)OC |
| InChI | InChI=1S/C9H17NO4.C7H12O3.C4H11NO2/c1-4-5-7(11)9(12)10-6-8(13-2)14-3;1-3-5-6(8)7(9)10-4-2;1-6-4(3-5)7-2/h8H,4-6H2,1-3H3,(H,10,12);3-5H2,1-2H3;4H,3,5H2,1-2H3 |
| InChIKey | VFMJWHBEOCQLIA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 152.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|