C31H40FI3N5O3- — CID 161284335
2-[(3R,4S)-1-[5-(4,4-dimethylcyclohexyl)-7-(N,2,6-trimethylanilino)pyrazolo[1,5-a]pyrimidine-2-carbonyl]-3-fluoropiperidin-4-yl]acetic acid triiodide (PubChem CID 161284335) has the molecular formula C31H40FI3N5O3- and a molecular weight of 930.40 g/mol. Its IUPAC name is 2-[(3R,4S)-1-[5-(4,4-dimethylcyclohexyl)-7-(N,2,6-trimethylanilino)pyrazolo[1,5-a]pyrimidine-2-carbonyl]-3-fluoropiperidin-4-yl]acetic acid triiodide.
| Compound Name | 2-[(3R,4S)-1-[5-(4,4-dimethylcyclohexyl)-7-(N,2,6-trimethylanilino)pyrazolo[1,5-a]pyrimidine-2-carbonyl]-3-fluoropiperidin-4-yl]acetic acid triiodide |
|---|---|
| PubChem CID | 161284335 |
| Molecular Formula | C31H40FI3N5O3- |
| Molecular Weight | 930.40 g/mol |
| Exact Mass | 930.03 |
| IUPAC Name | 2-[(3R,4S)-1-[5-(4,4-dimethylcyclohexyl)-7-(N,2,6-trimethylanilino)pyrazolo[1,5-a]pyrimidine-2-carbonyl]-3-fluoropiperidin-4-yl]acetic acid triiodide |
| SMILES | Cc1cccc(C)c1N(C)c1cc(C2CCC(C)(C)CC2)nc2cc(C(=O)N3CC[C@@H](CC(=O)O)[C@@H](F)C3)nn12.I[I-]I |
| InChI | InChI=1S/C31H40FN5O3.I3/c1-19-7-6-8-20(2)29(19)35(5)27-17-24(21-9-12-31(3,4)13-10-21)33-26-16-25(34-37(26)27)30(40)36-14-11-22(15-28(38)39)23(32)18-36;1-3-2/h6-8,16-17,21-23H,9-15,18H2,1-5H3,(H,38,39);/q;-1/t22-,23-;/m0./s1 |
| InChIKey | SRSDIBPDXGNTMF-SJEIDVEUSA-N |
| XLogP | 4.85 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|