C24H27BN2O3S — CID 161285199
[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-cyclopenta[b]pyridin-5-yl]-3,6-dihydro-2H-pyridin-1-yl]-thiophen-2-ylmethanone (PubChem CID 161285199) has the molecular formula C24H27BN2O3S and a molecular weight of 434.37 g/mol. Its IUPAC name is [4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-cyclopenta[b]pyridin-5-yl]-3,6-dihydro-2H-pyridin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-cyclopenta[b]pyridin-5-yl]-3,6-dihydro-2H-pyridin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 161285199 |
| Molecular Formula | C24H27BN2O3S |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | [4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-cyclopenta[b]pyridin-5-yl]-3,6-dihydro-2H-pyridin-1-yl]-thiophen-2-ylmethanone |
| SMILES | CC1(C)OB(c2cnc3c(c2)C(C2=CCN(C(=O)c4cccs4)CC2)=CC3)OC1(C)C |
| InChI | InChI=1S/C24H27BN2O3S/c1-23(2)24(3,4)30-25(29-23)17-14-19-18(7-8-20(19)26-15-17)16-9-11-27(12-10-16)22(28)21-6-5-13-31-21/h5-7,9,13-15H,8,10-12H2,1-4H3 |
| InChIKey | MMHKHIHECUUSSM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|