C15H26FN9O2S — CID 161291145
bis[2-(4,5-dihydro-1H-imidazol-2-yl)propan-2-yl]diazene;5-methyl-1H-1,2,4-triazole-3-sulfonyl fluoride (PubChem CID 161291145) has the molecular formula C15H26FN9O2S and a molecular weight of 415.50 g/mol. Its IUPAC name is bis[2-(4,5-dihydro-1H-imidazol-2-yl)propan-2-yl]diazene;5-methyl-1H-1,2,4-triazole-3-sulfonyl fluoride.
| Compound Name | bis[2-(4,5-dihydro-1H-imidazol-2-yl)propan-2-yl]diazene;5-methyl-1H-1,2,4-triazole-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 161291145 |
| Molecular Formula | C15H26FN9O2S |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | bis[2-(4,5-dihydro-1H-imidazol-2-yl)propan-2-yl]diazene;5-methyl-1H-1,2,4-triazole-3-sulfonyl fluoride |
| SMILES | CC(C)(/N=N/C(C)(C)C1=NCCN1)C1=NCCN1.Cc1nc(S(=O)(=O)F)n[nH]1 |
| InChI | InChI=1S/C12H22N6.C3H4FN3O2S/c1-11(2,9-13-5-6-14-9)17-18-12(3,4)10-15-7-8-16-10;1-2-5-3(7-6-2)10(4,8)9/h5-8H2,1-4H3,(H,13,14)(H,15,16);1H3,(H,5,6,7)/b18-17+; |
| InChIKey | VGIZHRWDRQSDNM-ZAGWXBKKSA-N |
| XLogP | 0.77 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|