About formic acid;1-(6-methoxy-1,2-benzothiazol-3-yl)-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone
formic acid;1-(6-methoxy-1,2-benzothiazol-3-yl)-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone (PubChem CID 161291162) has the molecular formula C19H24N2O4S
and a molecular weight of 376.48 g/mol. Its IUPAC name is formic acid;1-(6-methoxy-1,2-benzothiazol-3-yl)-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone.
Molecular Properties
| Compound Name | formic acid;1-(6-methoxy-1,2-benzothiazol-3-yl)-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone |
| PubChem CID | 161291162 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | formic acid;1-(6-methoxy-1,2-benzothiazol-3-yl)-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone |
| SMILES | COc1ccc2c(C(=O)CC3CC4CCC(C3)N4C)nsc2c1.O=CO |
| InChI | InChI=1S/C18H22N2O2S.CH2O2/c1-20-12-3-4-13(20)8-11(7-12)9-16(21)18-15-6-5-14(22-2)10-17(15)23-19-18;2-1-3/h5-6,10-13H,3-4,7-9H2,1-2H3;1H,(H,2,3) |
| InChIKey | VGJAIUABZMATKX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;1-(6-methoxy-1,2-benzothiazol-3-yl)-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;1-(6-methoxy-1,2-benzothiazol-3-yl)-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone?
The IUPAC name of formic acid;1-(6-methoxy-1,2-benzothiazol-3-yl)-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone (CID 161291162) is formic acid;1-(6-methoxy-1,2-benzothiazol-3-yl)-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone.
What is the SMILES notation for formic acid;1-(6-methoxy-1,2-benzothiazol-3-yl)-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone?
The canonical SMILES for formic acid;1-(6-methoxy-1,2-benzothiazol-3-yl)-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone is COc1ccc2c(C(=O)CC3CC4CCC(C3)N4C)nsc2c1.O=CO.
What is the InChIKey of formic acid;1-(6-methoxy-1,2-benzothiazol-3-yl)-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone?
The InChIKey is VGJAIUABZMATKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2S.CH2O2/c1-20-12-3-4-13(20)8-11(7-12)9-16(21)18-15-6-5-14(22-2)10-17(15)23-19-18;2-1-3/h5-6,10-13H,3-4,7-9H2,1-2H3;1H,(H,2,3).
What are the key properties of formic acid;1-(6-methoxy-1,2-benzothiazol-3-yl)-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone?
formic acid;1-(6-methoxy-1,2-benzothiazol-3-yl)-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone has a molecular weight of 376.48 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;1-(6-methoxy-1,2-benzothiazol-3-yl)-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone is sourced from PubChem (CID 161291162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).