About bis(3-ethyl-1-methylpyrrolidine);1-methylpyrrolidine
bis(3-ethyl-1-methylpyrrolidine);1-methylpyrrolidine (PubChem CID 161292212) has the molecular formula C19H41N3
and a molecular weight of 311.56 g/mol. Its IUPAC name is bis(3-ethyl-1-methylpyrrolidine);1-methylpyrrolidine.
Molecular Properties
| Compound Name | bis(3-ethyl-1-methylpyrrolidine);1-methylpyrrolidine |
| PubChem CID | 161292212 |
| Molecular Formula | C19H41N3 |
| Molecular Weight | 311.56 g/mol |
| Exact Mass | 311.33 |
| IUPAC Name | bis(3-ethyl-1-methylpyrrolidine);1-methylpyrrolidine |
| SMILES | CCC1CCN(C)C1.CCC1CCN(C)C1.CN1CCCC1 |
| InChI | InChI=1S/2C7H15N.C5H11N/c2*1-3-7-4-5-8(2)6-7;1-6-4-2-3-5-6/h2*7H,3-6H2,1-2H3;2-5H2,1H3 |
| InChIKey | VGMUAYNELKHRMD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(3-ethyl-1-methylpyrrolidine);1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-ethyl-1-methylpyrrolidine);1-methylpyrrolidine?
The IUPAC name of bis(3-ethyl-1-methylpyrrolidine);1-methylpyrrolidine (CID 161292212) is bis(3-ethyl-1-methylpyrrolidine);1-methylpyrrolidine.
What is the SMILES notation for bis(3-ethyl-1-methylpyrrolidine);1-methylpyrrolidine?
The canonical SMILES for bis(3-ethyl-1-methylpyrrolidine);1-methylpyrrolidine is CCC1CCN(C)C1.CCC1CCN(C)C1.CN1CCCC1.
What is the InChIKey of bis(3-ethyl-1-methylpyrrolidine);1-methylpyrrolidine?
The InChIKey is VGMUAYNELKHRMD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H15N.C5H11N/c2*1-3-7-4-5-8(2)6-7;1-6-4-2-3-5-6/h2*7H,3-6H2,1-2H3;2-5H2,1H3.
What are the key properties of bis(3-ethyl-1-methylpyrrolidine);1-methylpyrrolidine?
bis(3-ethyl-1-methylpyrrolidine);1-methylpyrrolidine has a molecular weight of 311.56 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-ethyl-1-methylpyrrolidine);1-methylpyrrolidine is sourced from PubChem (CID 161292212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).