About manganese;3-sulfanylpropanoic acid;zinc
manganese;3-sulfanylpropanoic acid;zinc (PubChem CID 161292354) has the molecular formula C3H6MnO2SZn
and a molecular weight of 226.47 g/mol. Its IUPAC name is manganese;3-sulfanylpropanoic acid;zinc.
Molecular Properties
| Compound Name | manganese;3-sulfanylpropanoic acid;zinc |
| PubChem CID | 161292354 |
| Molecular Formula | C3H6MnO2SZn |
| Molecular Weight | 226.47 g/mol |
| Exact Mass | 224.88 |
| IUPAC Name | manganese;3-sulfanylpropanoic acid;zinc |
| SMILES | O=C(O)CCS.[Mn].[Zn] |
| InChI | InChI=1S/C3H6O2S.Mn.Zn/c4-3(5)1-2-6;;/h6H,1-2H2,(H,4,5);; |
| InChIKey | VGNDTLULWFYOFS-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.47 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze manganese;3-sulfanylpropanoic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese;3-sulfanylpropanoic acid;zinc?
The IUPAC name of manganese;3-sulfanylpropanoic acid;zinc (CID 161292354) is manganese;3-sulfanylpropanoic acid;zinc.
What is the SMILES notation for manganese;3-sulfanylpropanoic acid;zinc?
The canonical SMILES for manganese;3-sulfanylpropanoic acid;zinc is O=C(O)CCS.[Mn].[Zn].
What is the InChIKey of manganese;3-sulfanylpropanoic acid;zinc?
The InChIKey is VGNDTLULWFYOFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2S.Mn.Zn/c4-3(5)1-2-6;;/h6H,1-2H2,(H,4,5);;.
What are the key properties of manganese;3-sulfanylpropanoic acid;zinc?
manganese;3-sulfanylpropanoic acid;zinc has a molecular weight of 226.47 g/mol, XLogP of 0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for manganese;3-sulfanylpropanoic acid;zinc is sourced from PubChem (CID 161292354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).