C18H10Br3FN4O6 — CID 161294381
2,5-dibromo-3-nitropyridine;methyl 3-(5-bromo-3-nitro-2-pyridinyl)-4-fluorobenzoate (PubChem CID 161294381) has the molecular formula C18H10Br3FN4O6 and a molecular weight of 637.01 g/mol. Its IUPAC name is 2,5-dibromo-3-nitropyridine;methyl 3-(5-bromo-3-nitro-2-pyridinyl)-4-fluorobenzoate.
| Compound Name | 2,5-dibromo-3-nitropyridine;methyl 3-(5-bromo-3-nitro-2-pyridinyl)-4-fluorobenzoate |
|---|---|
| PubChem CID | 161294381 |
| Molecular Formula | C18H10Br3FN4O6 |
| Molecular Weight | 637.01 g/mol |
| Exact Mass | 633.81 |
| IUPAC Name | 2,5-dibromo-3-nitropyridine;methyl 3-(5-bromo-3-nitro-2-pyridinyl)-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)c(-c2ncc(Br)cc2[N+](=O)[O-])c1.O=[N+]([O-])c1cc(Br)cnc1Br |
| InChI | InChI=1S/C13H8BrFN2O4.C5H2Br2N2O2/c1-21-13(18)7-2-3-10(15)9(4-7)12-11(17(19)20)5-8(14)6-16-12;6-3-1-4(9(10)11)5(7)8-2-3/h2-6H,1H3;1-2H |
| InChIKey | VGTYIIYUSDOKDL-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 138.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.01 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|