About tert-butylcyclohexane;4-tert-butyl-1,1-difluorocyclohexane;1-tert-butylpiperidine
tert-butylcyclohexane;4-tert-butyl-1,1-difluorocyclohexane;1-tert-butylpiperidine (PubChem CID 161294557) has the molecular formula C29H57F2N
and a molecular weight of 457.78 g/mol. Its IUPAC name is tert-butylcyclohexane;4-tert-butyl-1,1-difluorocyclohexane;1-tert-butylpiperidine.
Molecular Properties
| Compound Name | tert-butylcyclohexane;4-tert-butyl-1,1-difluorocyclohexane;1-tert-butylpiperidine |
| PubChem CID | 161294557 |
| Molecular Formula | C29H57F2N |
| Molecular Weight | 457.78 g/mol |
| Exact Mass | 457.45 |
| IUPAC Name | tert-butylcyclohexane;4-tert-butyl-1,1-difluorocyclohexane;1-tert-butylpiperidine |
| SMILES | CC(C)(C)C1CCC(F)(F)CC1.CC(C)(C)C1CCCCC1.CC(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C10H18F2.C10H20.C9H19N/c1-9(2,3)8-4-6-10(11,12)7-5-8;1-10(2,3)9-7-5-4-6-8-9;1-9(2,3)10-7-5-4-6-8-10/h8H,4-7H2,1-3H3;9H,4-8H2,1-3H3;4-8H2,1-3H3 |
| InChIKey | VGUKYMLINDSSFY-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.78 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tert-butylcyclohexane;4-tert-butyl-1,1-difluorocyclohexane;1-tert-butylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylcyclohexane;4-tert-butyl-1,1-difluorocyclohexane;1-tert-butylpiperidine?
The IUPAC name of tert-butylcyclohexane;4-tert-butyl-1,1-difluorocyclohexane;1-tert-butylpiperidine (CID 161294557) is tert-butylcyclohexane;4-tert-butyl-1,1-difluorocyclohexane;1-tert-butylpiperidine.
What is the SMILES notation for tert-butylcyclohexane;4-tert-butyl-1,1-difluorocyclohexane;1-tert-butylpiperidine?
The canonical SMILES for tert-butylcyclohexane;4-tert-butyl-1,1-difluorocyclohexane;1-tert-butylpiperidine is CC(C)(C)C1CCC(F)(F)CC1.CC(C)(C)C1CCCCC1.CC(C)(C)N1CCCCC1.
What is the InChIKey of tert-butylcyclohexane;4-tert-butyl-1,1-difluorocyclohexane;1-tert-butylpiperidine?
The InChIKey is VGUKYMLINDSSFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2.C10H20.C9H19N/c1-9(2,3)8-4-6-10(11,12)7-5-8;1-10(2,3)9-7-5-4-6-8-9;1-9(2,3)10-7-5-4-6-8-10/h8H,4-7H2,1-3H3;9H,4-8H2,1-3H3;4-8H2,1-3H3.
What are the key properties of tert-butylcyclohexane;4-tert-butyl-1,1-difluorocyclohexane;1-tert-butylpiperidine?
tert-butylcyclohexane;4-tert-butyl-1,1-difluorocyclohexane;1-tert-butylpiperidine has a molecular weight of 457.78 g/mol, XLogP of 9.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylcyclohexane;4-tert-butyl-1,1-difluorocyclohexane;1-tert-butylpiperidine is sourced from PubChem (CID 161294557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).