C34H28F4N4O4 — CID 161295255
1-[(3,4-difluorophenyl)methyl]-4,6-dimethyl-5-nitroindole;1-[(3,5-difluorophenyl)methyl]-4,6-dimethyl-5-nitroindole (PubChem CID 161295255) has the molecular formula C34H28F4N4O4 and a molecular weight of 632.61 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-4,6-dimethyl-5-nitroindole;1-[(3,5-difluorophenyl)methyl]-4,6-dimethyl-5-nitroindole.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-4,6-dimethyl-5-nitroindole;1-[(3,5-difluorophenyl)methyl]-4,6-dimethyl-5-nitroindole |
|---|---|
| PubChem CID | 161295255 |
| Molecular Formula | C34H28F4N4O4 |
| Molecular Weight | 632.61 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-4,6-dimethyl-5-nitroindole;1-[(3,5-difluorophenyl)methyl]-4,6-dimethyl-5-nitroindole |
| SMILES | Cc1cc2c(ccn2Cc2cc(F)cc(F)c2)c(C)c1[N+](=O)[O-].Cc1cc2c(ccn2Cc2ccc(F)c(F)c2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/2C17H14F2N2O2/c1-10-5-16-15(11(2)17(10)21(22)23)3-4-20(16)9-12-6-13(18)8-14(19)7-12;1-10-7-16-13(11(2)17(10)21(22)23)5-6-20(16)9-12-3-4-14(18)15(19)8-12/h2*3-8H,9H2,1-2H3 |
| InChIKey | VGWSENZHTKSPED-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 96.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.61 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|