About furan-2,5-dione;3-methylpyrrole-2,5-dione
furan-2,5-dione;3-methylpyrrole-2,5-dione (PubChem CID 161296251) has the molecular formula C9H7NO5
and a molecular weight of 209.16 g/mol. Its IUPAC name is furan-2,5-dione;3-methylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | furan-2,5-dione;3-methylpyrrole-2,5-dione |
| PubChem CID | 161296251 |
| Molecular Formula | C9H7NO5 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | furan-2,5-dione;3-methylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)NC1=O.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C5H5NO2.C4H2O3/c1-3-2-4(7)6-5(3)8;5-3-1-2-4(6)7-3/h2H,1H3,(H,6,7,8);1-2H |
| InChIKey | VGZWPLLATCWYDM-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze furan-2,5-dione;3-methylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2,5-dione;3-methylpyrrole-2,5-dione?
The IUPAC name of furan-2,5-dione;3-methylpyrrole-2,5-dione (CID 161296251) is furan-2,5-dione;3-methylpyrrole-2,5-dione.
What is the SMILES notation for furan-2,5-dione;3-methylpyrrole-2,5-dione?
The canonical SMILES for furan-2,5-dione;3-methylpyrrole-2,5-dione is CC1=CC(=O)NC1=O.O=C1C=CC(=O)O1.
What is the InChIKey of furan-2,5-dione;3-methylpyrrole-2,5-dione?
The InChIKey is VGZWPLLATCWYDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2.C4H2O3/c1-3-2-4(7)6-5(3)8;5-3-1-2-4(6)7-3/h2H,1H3,(H,6,7,8);1-2H.
What are the key properties of furan-2,5-dione;3-methylpyrrole-2,5-dione?
furan-2,5-dione;3-methylpyrrole-2,5-dione has a molecular weight of 209.16 g/mol, XLogP of -0.78, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2,5-dione;3-methylpyrrole-2,5-dione is sourced from PubChem (CID 161296251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).