C21H32F3NO12 — CID 161296801
(6R,7S)-10-(3-hydroxypropyl)-4-methoxy-4-methyl-3,5,13-trioxa-10-azatetracyclo[5.5.1.02,6.08,12]tridecane-9,11-dione;2,2,2-trifluoroacetic acid;1,1,1-trimethoxyethane (PubChem CID 161296801) has the molecular formula C21H32F3NO12 and a molecular weight of 547.48 g/mol. Its IUPAC name is (6R,7S)-10-(3-hydroxypropyl)-4-methoxy-4-methyl-3,5,13-trioxa-10-azatetracyclo[5.5.1.02,6.08,12]tridecane-9,11-dione;2,2,2-trifluoroacetic acid;1,1,1-trimethoxyethane.
| Compound Name | (6R,7S)-10-(3-hydroxypropyl)-4-methoxy-4-methyl-3,5,13-trioxa-10-azatetracyclo[5.5.1.02,6.08,12]tridecane-9,11-dione;2,2,2-trifluoroacetic acid;1,1,1-trimethoxyethane |
|---|---|
| PubChem CID | 161296801 |
| Molecular Formula | C21H32F3NO12 |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | (6R,7S)-10-(3-hydroxypropyl)-4-methoxy-4-methyl-3,5,13-trioxa-10-azatetracyclo[5.5.1.02,6.08,12]tridecane-9,11-dione;2,2,2-trifluoroacetic acid;1,1,1-trimethoxyethane |
| SMILES | COC(C)(OC)OC.COC1(C)OC2C3O[C@@H](C4C(=O)N(CCCO)C(=O)C34)[C@H]2O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H19NO7.C5H12O3.C2HF3O2/c1-14(19-2)21-10-8-6-7(9(20-8)11(10)22-14)13(18)15(12(6)17)4-3-5-16;1-5(6-2,7-3)8-4;3-2(4,5)1(6)7/h6-11,16H,3-5H2,1-2H3;1-4H3;(H,6,7)/t6?,7?,8-,9?,10+,11?,14?;;/m0../s1 |
| InChIKey | CDLLDCVAHWJPDP-DMRKJARCSA-N |
| XLogP | 0.09 |
| TPSA | 159.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|