C12H8F3I4NO6S — CID 161296869
3,3,3-trifluoro-2-[(2,3,4,5-tetraiodo-6-methoxycarbonylbenzoyl)amino]propane-1-sulfonic acid (PubChem CID 161296869) has the molecular formula C12H8F3I4NO6S and a molecular weight of 858.87 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(2,3,4,5-tetraiodo-6-methoxycarbonylbenzoyl)amino]propane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-[(2,3,4,5-tetraiodo-6-methoxycarbonylbenzoyl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 161296869 |
| Molecular Formula | C12H8F3I4NO6S |
| Molecular Weight | 858.87 g/mol |
| Exact Mass | 858.62 |
| IUPAC Name | 3,3,3-trifluoro-2-[(2,3,4,5-tetraiodo-6-methoxycarbonylbenzoyl)amino]propane-1-sulfonic acid |
| SMILES | COC(=O)c1c(I)c(I)c(I)c(I)c1C(=O)NC(CS(=O)(=O)O)C(F)(F)F |
| InChI | InChI=1S/C12H8F3I4NO6S/c1-26-11(22)5-4(6(16)8(18)9(19)7(5)17)10(21)20-3(12(13,14)15)2-27(23,24)25/h3H,2H2,1H3,(H,20,21)(H,23,24,25) |
| InChIKey | GODLTZHELIOBAG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.87 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|