C21H20N2O5S — CID 161297693
methyl 6-[7-oxo-7-(5-thiophen-2-yl-1,2-oxazol-3-yl)heptanoyl]pyridine-3-carboxylate (PubChem CID 161297693) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is methyl 6-[7-oxo-7-(5-thiophen-2-yl-1,2-oxazol-3-yl)heptanoyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[7-oxo-7-(5-thiophen-2-yl-1,2-oxazol-3-yl)heptanoyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 161297693 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | methyl 6-[7-oxo-7-(5-thiophen-2-yl-1,2-oxazol-3-yl)heptanoyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)CCCCCC(=O)c2cc(-c3cccs3)on2)nc1 |
| InChI | InChI=1S/C21H20N2O5S/c1-27-21(26)14-9-10-15(22-13-14)17(24)6-3-2-4-7-18(25)16-12-19(28-23-16)20-8-5-11-29-20/h5,8-13H,2-4,6-7H2,1H3 |
| InChIKey | VHEQFTADWPVXFH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|