C14H31NO3 — CID 161298083
2-[bis(2-hydroxyethyl)amino]-3,3,5,5-tetramethylhexan-1-ol (PubChem CID 161298083) has the molecular formula C14H31NO3 and a molecular weight of 261.41 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]-3,3,5,5-tetramethylhexan-1-ol.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]-3,3,5,5-tetramethylhexan-1-ol |
|---|---|
| PubChem CID | 161298083 |
| Molecular Formula | C14H31NO3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.23 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]-3,3,5,5-tetramethylhexan-1-ol |
| SMILES | CC(C)(C)CC(C)(C)C(CO)N(CCO)CCO |
| InChI | InChI=1S/C14H31NO3/c1-13(2,3)11-14(4,5)12(10-18)15(6-8-16)7-9-17/h12,16-18H,6-11H2,1-5H3 |
| InChIKey | VHFYBVSGTCAQAI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |