C28H35N3O3Si — CID 161298419
methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[4-[4-(4-trimethylsilylbuta-1,3-diynyl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate (PubChem CID 161298419) has the molecular formula C28H35N3O3Si and a molecular weight of 489.69 g/mol. Its IUPAC name is methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[4-[4-(4-trimethylsilylbuta-1,3-diynyl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[4-[4-(4-trimethylsilylbuta-1,3-diynyl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 161298419 |
| Molecular Formula | C28H35N3O3Si |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[4-[4-(4-trimethylsilylbuta-1,3-diynyl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C1=NC=C(c2ccc(C#CC#C[Si](C)(C)C)cc2)C1)C(C)C |
| InChI | InChI=1S/C28H35N3O3Si/c1-20(2)26(30-28(33)34-3)27(32)31-16-9-11-25(31)24-18-23(19-29-24)22-14-12-21(13-15-22)10-7-8-17-35(4,5)6/h12-15,19-20,25-26H,9,11,16,18H2,1-6H3,(H,30,33)/t25-,26-/m0/s1 |
| InChIKey | UESVUDGTMMHSRX-UIOOFZCWSA-N |
| XLogP | 4.48 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|