About sodium;hydride;naphthalene
sodium;hydride;naphthalene (PubChem CID 161298923) has the molecular formula C10H9Na
and a molecular weight of 152.17 g/mol. Its IUPAC name is sodium;hydride;naphthalene.
Molecular Properties
| Compound Name | sodium;hydride;naphthalene |
| PubChem CID | 161298923 |
| Molecular Formula | C10H9Na |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | sodium;hydride;naphthalene |
| SMILES | [H-].[Na+].c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.Na.H/c1-2-6-10-8-4-3-7-9(10)5-1;;/h1-8H;;/q;+1;-1 |
| InChIKey | VHINQUDXDWOFNI-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze sodium;hydride;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;naphthalene?
The IUPAC name of sodium;hydride;naphthalene (CID 161298923) is sodium;hydride;naphthalene.
What is the SMILES notation for sodium;hydride;naphthalene?
The canonical SMILES for sodium;hydride;naphthalene is [H-].[Na+].c1ccc2ccccc2c1.
What is the InChIKey of sodium;hydride;naphthalene?
The InChIKey is VHINQUDXDWOFNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.Na.H/c1-2-6-10-8-4-3-7-9(10)5-1;;/h1-8H;;/q;+1;-1.
What are the key properties of sodium;hydride;naphthalene?
sodium;hydride;naphthalene has a molecular weight of 152.17 g/mol, XLogP of -0.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;naphthalene is sourced from PubChem (CID 161298923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).