C12H23NO5S — CID 161301582
1,4-dimethylcyclohexa-2,4-diene-1-sulfonic acid;2-(2-hydroxyethylamino)ethanol (PubChem CID 161301582) has the molecular formula C12H23NO5S and a molecular weight of 293.39 g/mol. Its IUPAC name is 1,4-dimethylcyclohexa-2,4-diene-1-sulfonic acid;2-(2-hydroxyethylamino)ethanol.
| Compound Name | 1,4-dimethylcyclohexa-2,4-diene-1-sulfonic acid;2-(2-hydroxyethylamino)ethanol |
|---|---|
| PubChem CID | 161301582 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 1,4-dimethylcyclohexa-2,4-diene-1-sulfonic acid;2-(2-hydroxyethylamino)ethanol |
| SMILES | CC1=CCC(C)(S(=O)(=O)O)C=C1.OCCNCCO |
| InChI | InChI=1S/C8H12O3S.C4H11NO2/c1-7-3-5-8(2,6-4-7)12(9,10)11;6-3-1-5-2-4-7/h3-5H,6H2,1-2H3,(H,9,10,11);5-7H,1-4H2 |
| InChIKey | VHRPJJBTBLIUAT-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|