C14H21F3O9S — CID 161303119
[(3R,3aR,6S,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] trifluoromethanesulfonate;(3R,3aR,6S,6aR)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol (PubChem CID 161303119) has the molecular formula C14H21F3O9S and a molecular weight of 422.37 g/mol. Its IUPAC name is [(3R,3aR,6S,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] trifluoromethanesulfonate;(3R,3aR,6S,6aR)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol.
| Compound Name | [(3R,3aR,6S,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] trifluoromethanesulfonate;(3R,3aR,6S,6aR)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 161303119 |
| Molecular Formula | C14H21F3O9S |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | [(3R,3aR,6S,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] trifluoromethanesulfonate;(3R,3aR,6S,6aR)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
| SMILES | C[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O.O=S(=O)(O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O)C(F)(F)F |
| InChI | InChI=1S/C7H9F3O6S.C7H12O3/c8-7(9,10)17(12,13)16-4-2-15-5-3(11)1-14-6(4)5;1-4-2-9-7-5(8)3-10-6(4)7/h3-6,11H,1-2H2;4-8H,2-3H2,1H3/t3-,4+,5-,6-;4-,5+,6-,7-/m11/s1 |
| InChIKey | VHWPJWDSAXJBGX-RTUGTHTBSA-N |
| XLogP | -0.84 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|