C14H36N6 — CID 161304466
2-tert-butyl-N,N'-bis(methylaminomethyl)-2-[(methylaminomethylamino)methyl]propane-1,3-diamine (PubChem CID 161304466) has the molecular formula C14H36N6 and a molecular weight of 288.48 g/mol. Its IUPAC name is 2-tert-butyl-N,N'-bis(methylaminomethyl)-2-[(methylaminomethylamino)methyl]propane-1,3-diamine.
| Compound Name | 2-tert-butyl-N,N'-bis(methylaminomethyl)-2-[(methylaminomethylamino)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 161304466 |
| Molecular Formula | C14H36N6 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.30 |
| IUPAC Name | 2-tert-butyl-N,N'-bis(methylaminomethyl)-2-[(methylaminomethylamino)methyl]propane-1,3-diamine |
| SMILES | CNCNCC(CNCNC)(CNCNC)C(C)(C)C |
| InChI | InChI=1S/C14H36N6/c1-13(2,3)14(7-18-10-15-4,8-19-11-16-5)9-20-12-17-6/h15-20H,7-12H2,1-6H3 |
| InChIKey | IIRVMYKAWJTPIW-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|