About dimethyl(propyl)borane;methane
dimethyl(propyl)borane;methane (PubChem CID 161304479) has the molecular formula C7H21B
and a molecular weight of 116.06 g/mol. Its IUPAC name is dimethyl(propyl)borane;methane.
Molecular Properties
| Compound Name | dimethyl(propyl)borane;methane |
| PubChem CID | 161304479 |
| Molecular Formula | C7H21B |
| Molecular Weight | 116.06 g/mol |
| Exact Mass | 116.17 |
| IUPAC Name | dimethyl(propyl)borane;methane |
| SMILES | C.C.CCCB(C)C |
| InChI | InChI=1S/C5H13B.2CH4/c1-4-5-6(2)3;;/h4-5H2,1-3H3;2*1H4 |
| InChIKey | VIBGJKUGQKWXBA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.06 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(propyl)borane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(propyl)borane;methane?
The IUPAC name of dimethyl(propyl)borane;methane (CID 161304479) is dimethyl(propyl)borane;methane.
What is the SMILES notation for dimethyl(propyl)borane;methane?
The canonical SMILES for dimethyl(propyl)borane;methane is C.C.CCCB(C)C.
What is the InChIKey of dimethyl(propyl)borane;methane?
The InChIKey is VIBGJKUGQKWXBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13B.2CH4/c1-4-5-6(2)3;;/h4-5H2,1-3H3;2*1H4.
What are the key properties of dimethyl(propyl)borane;methane?
dimethyl(propyl)borane;methane has a molecular weight of 116.06 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(propyl)borane;methane is sourced from PubChem (CID 161304479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).