C26H50N2O4 — CID 161304756
1-(3-methyl-2-oxobutyl)pyrrolidine-2,5-dione;4-methyl-1-piperidin-1-ylpentan-3-one;propane (PubChem CID 161304756) has the molecular formula C26H50N2O4 and a molecular weight of 454.70 g/mol. Its IUPAC name is 1-(3-methyl-2-oxobutyl)pyrrolidine-2,5-dione;4-methyl-1-piperidin-1-ylpentan-3-one;propane.
| Compound Name | 1-(3-methyl-2-oxobutyl)pyrrolidine-2,5-dione;4-methyl-1-piperidin-1-ylpentan-3-one;propane |
|---|---|
| PubChem CID | 161304756 |
| Molecular Formula | C26H50N2O4 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | 1-(3-methyl-2-oxobutyl)pyrrolidine-2,5-dione;4-methyl-1-piperidin-1-ylpentan-3-one;propane |
| SMILES | CC(C)C(=O)CCN1CCCCC1.CC(C)C(=O)CN1C(=O)CCC1=O.CCC.CCC |
| InChI | InChI=1S/C11H21NO.C9H13NO3.2C3H8/c1-10(2)11(13)6-9-12-7-4-3-5-8-12;1-6(2)7(11)5-10-8(12)3-4-9(10)13;2*1-3-2/h10H,3-9H2,1-2H3;6H,3-5H2,1-2H3;2*3H2,1-2H3 |
| InChIKey | VICFXYURMVIVBE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|