C31H62O3Si2 — CID 161304775
(2R,3R,4S,6S,9R,10S,11R,12S,13Z)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6,9,10,12-hexamethyl-11-trimethylsilyloxyhexadeca-13,15-dienal (PubChem CID 161304775) has the molecular formula C31H62O3Si2 and a molecular weight of 539.01 g/mol. Its IUPAC name is (2R,3R,4S,6S,9R,10S,11R,12S,13Z)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6,9,10,12-hexamethyl-11-trimethylsilyloxyhexadeca-13,15-dienal.
| Compound Name | (2R,3R,4S,6S,9R,10S,11R,12S,13Z)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6,9,10,12-hexamethyl-11-trimethylsilyloxyhexadeca-13,15-dienal |
|---|---|
| PubChem CID | 161304775 |
| Molecular Formula | C31H62O3Si2 |
| Molecular Weight | 539.01 g/mol |
| Exact Mass | 538.42 |
| IUPAC Name | (2R,3R,4S,6S,9R,10S,11R,12S,13Z)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6,9,10,12-hexamethyl-11-trimethylsilyloxyhexadeca-13,15-dienal |
| SMILES | C=C/C=C\[C@H](C)[C@H](O[Si](C)(C)C)[C@@H](C)[C@H](C)CC[C@H](C)C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O |
| InChI | InChI=1S/C31H62O3Si2/c1-16-17-18-25(4)30(33-35(11,12)13)28(7)24(3)20-19-23(2)21-26(5)29(27(6)22-32)34-36(14,15)31(8,9)10/h16-18,22-30H,1,19-21H2,2-15H3/b18-17-/t23-,24+,25-,26-,27-,28-,29+,30-/m0/s1 |
| InChIKey | IGJHHJAPBHDMTL-DJRSQAQFSA-N |
| XLogP | 9.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.01 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|