C18H18BN4O5 — CID 161305232
CID 161305232 (PubChem CID 161305232) has the molecular formula C18H18BN4O5 and a molecular weight of 381.18 g/mol.
| Compound Name | CID 161305232 |
|---|---|
| PubChem CID | 161305232 |
| Molecular Formula | C18H18BN4O5 |
| Molecular Weight | 381.18 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | — |
| SMILES | O=C(Nc1ncnc2c1ccn2[C@@H]1O[C@H](CO)C(O)[C@@H]1O)c1ccccc1.[B] |
| InChI | InChI=1S/C18H18N4O5.B/c23-8-12-13(24)14(25)18(27-12)22-7-6-11-15(19-9-20-16(11)22)21-17(26)10-4-2-1-3-5-10;/h1-7,9,12-14,18,23-25H,8H2,(H,19,20,21,26);/t12-,13?,14+,18-;/m1./s1 |
| InChIKey | WTJQXAAVKNVZRF-NBAUWXQHSA-N |
| XLogP | -0.09 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.18 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|