C29H41N7O4 — CID 161305619
(5-methoxyimino-1,4,6,7-tetrahydroindol-2-yl)-(4-methylpiperazin-1-yl)methanone;2-(4-methylpiperazine-1-carbonyl)-1,4,6,7-tetrahydroindol-5-one (PubChem CID 161305619) has the molecular formula C29H41N7O4 and a molecular weight of 551.69 g/mol. Its IUPAC name is (5-methoxyimino-1,4,6,7-tetrahydroindol-2-yl)-(4-methylpiperazin-1-yl)methanone;2-(4-methylpiperazine-1-carbonyl)-1,4,6,7-tetrahydroindol-5-one.
| Compound Name | (5-methoxyimino-1,4,6,7-tetrahydroindol-2-yl)-(4-methylpiperazin-1-yl)methanone;2-(4-methylpiperazine-1-carbonyl)-1,4,6,7-tetrahydroindol-5-one |
|---|---|
| PubChem CID | 161305619 |
| Molecular Formula | C29H41N7O4 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.32 |
| IUPAC Name | (5-methoxyimino-1,4,6,7-tetrahydroindol-2-yl)-(4-methylpiperazin-1-yl)methanone;2-(4-methylpiperazine-1-carbonyl)-1,4,6,7-tetrahydroindol-5-one |
| SMILES | CN1CCN(C(=O)c2cc3c([nH]2)CCC(=O)C3)CC1.CON=C1CCc2[nH]c(C(=O)N3CCN(C)CC3)cc2C1 |
| InChI | InChI=1S/C15H22N4O2.C14H19N3O2/c1-18-5-7-19(8-6-18)15(20)14-10-11-9-12(17-21-2)3-4-13(11)16-14;1-16-4-6-17(7-5-16)14(19)13-9-10-8-11(18)2-3-12(10)15-13/h10,16H,3-9H2,1-2H3;9,15H,2-8H2,1H3 |
| InChIKey | VIEZYGWAJXETGZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|