About 2-butyl-2,3-dihydrothiochromen-4-one;2-butyl-3-hydroxythiochromen-4-one
2-butyl-2,3-dihydrothiochromen-4-one;2-butyl-3-hydroxythiochromen-4-one (PubChem CID 161306770) has the molecular formula C26H30O3S2
and a molecular weight of 454.66 g/mol. Its IUPAC name is 2-butyl-2,3-dihydrothiochromen-4-one;2-butyl-3-hydroxythiochromen-4-one.
Molecular Properties
| Compound Name | 2-butyl-2,3-dihydrothiochromen-4-one;2-butyl-3-hydroxythiochromen-4-one |
| PubChem CID | 161306770 |
| Molecular Formula | C26H30O3S2 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 2-butyl-2,3-dihydrothiochromen-4-one;2-butyl-3-hydroxythiochromen-4-one |
| SMILES | CCCCC1CC(=O)c2ccccc2S1.CCCCc1sc2ccccc2c(=O)c1O |
| InChI | InChI=1S/C13H14O2S.C13H16OS/c1-2-3-7-11-13(15)12(14)9-6-4-5-8-10(9)16-11;1-2-3-6-10-9-12(14)11-7-4-5-8-13(11)15-10/h4-6,8,15H,2-3,7H2,1H3;4-5,7-8,10H,2-3,6,9H2,1H3 |
| InChIKey | VIISVGIMQAYAAE-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-butyl-2,3-dihydrothiochromen-4-one;2-butyl-3-hydroxythiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-2,3-dihydrothiochromen-4-one;2-butyl-3-hydroxythiochromen-4-one?
The IUPAC name of 2-butyl-2,3-dihydrothiochromen-4-one;2-butyl-3-hydroxythiochromen-4-one (CID 161306770) is 2-butyl-2,3-dihydrothiochromen-4-one;2-butyl-3-hydroxythiochromen-4-one.
What is the SMILES notation for 2-butyl-2,3-dihydrothiochromen-4-one;2-butyl-3-hydroxythiochromen-4-one?
The canonical SMILES for 2-butyl-2,3-dihydrothiochromen-4-one;2-butyl-3-hydroxythiochromen-4-one is CCCCC1CC(=O)c2ccccc2S1.CCCCc1sc2ccccc2c(=O)c1O.
What is the InChIKey of 2-butyl-2,3-dihydrothiochromen-4-one;2-butyl-3-hydroxythiochromen-4-one?
The InChIKey is VIISVGIMQAYAAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O2S.C13H16OS/c1-2-3-7-11-13(15)12(14)9-6-4-5-8-10(9)16-11;1-2-3-6-10-9-12(14)11-7-4-5-8-13(11)15-10/h4-6,8,15H,2-3,7H2,1H3;4-5,7-8,10H,2-3,6,9H2,1H3.
What are the key properties of 2-butyl-2,3-dihydrothiochromen-4-one;2-butyl-3-hydroxythiochromen-4-one?
2-butyl-2,3-dihydrothiochromen-4-one;2-butyl-3-hydroxythiochromen-4-one has a molecular weight of 454.66 g/mol, XLogP of 7.23, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-2,3-dihydrothiochromen-4-one;2-butyl-3-hydroxythiochromen-4-one is sourced from PubChem (CID 161306770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).