About potassium;2-methylpropan-2-olate;spiro[2.5]octane-8-carbonitrile
potassium;2-methylpropan-2-olate;spiro[2.5]octane-8-carbonitrile (PubChem CID 161308214) has the molecular formula C13H22KNO
and a molecular weight of 247.42 g/mol. Its IUPAC name is potassium;2-methylpropan-2-olate;spiro[2.5]octane-8-carbonitrile.
Molecular Properties
| Compound Name | potassium;2-methylpropan-2-olate;spiro[2.5]octane-8-carbonitrile |
| PubChem CID | 161308214 |
| Molecular Formula | C13H22KNO |
| Molecular Weight | 247.42 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | potassium;2-methylpropan-2-olate;spiro[2.5]octane-8-carbonitrile |
| SMILES | CC(C)(C)[O-].N#CC1CCCCC12CC2.[K+] |
| InChI | InChI=1S/C9H13N.C4H9O.K/c10-7-8-3-1-2-4-9(8)5-6-9;1-4(2,3)5;/h8H,1-6H2;1-3H3;/q;-1;+1 |
| InChIKey | GZCUSYKLAZCPHY-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 46.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.42 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium;2-methylpropan-2-olate;spiro[2.5]octane-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-methylpropan-2-olate;spiro[2.5]octane-8-carbonitrile?
The IUPAC name of potassium;2-methylpropan-2-olate;spiro[2.5]octane-8-carbonitrile (CID 161308214) is potassium;2-methylpropan-2-olate;spiro[2.5]octane-8-carbonitrile.
What is the SMILES notation for potassium;2-methylpropan-2-olate;spiro[2.5]octane-8-carbonitrile?
The canonical SMILES for potassium;2-methylpropan-2-olate;spiro[2.5]octane-8-carbonitrile is CC(C)(C)[O-].N#CC1CCCCC12CC2.[K+].
What is the InChIKey of potassium;2-methylpropan-2-olate;spiro[2.5]octane-8-carbonitrile?
The InChIKey is GZCUSYKLAZCPHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.C4H9O.K/c10-7-8-3-1-2-4-9(8)5-6-9;1-4(2,3)5;/h8H,1-6H2;1-3H3;/q;-1;+1.
What are the key properties of potassium;2-methylpropan-2-olate;spiro[2.5]octane-8-carbonitrile?
potassium;2-methylpropan-2-olate;spiro[2.5]octane-8-carbonitrile has a molecular weight of 247.42 g/mol, XLogP of -0.37, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-methylpropan-2-olate;spiro[2.5]octane-8-carbonitrile is sourced from PubChem (CID 161308214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).